C14H12F3N3O2 — CID 19477477
N-(4-acetylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19477477) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19477477 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(4-acetylphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cc(C(F)(F)F)nn2C)cc1 |
| InChI | InChI=1S/C14H12F3N3O2/c1-8(21)9-3-5-10(6-4-9)18-13(22)11-7-12(14(15,16)17)19-20(11)2/h3-7H,1-2H3,(H,18,22) |
| InChIKey | NLYMUCWJIOGANL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |