C18H15F3N4O — CID 58487503
4-methyl-N-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-pyridinyl]benzamide (PubChem CID 58487503) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is 4-methyl-N-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-pyridinyl]benzamide.
| Compound Name | 4-methyl-N-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 58487503 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-methyl-N-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-3-pyridinyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(-c3cc(C(F)(F)F)nn3C)nc2)cc1 |
| InChI | InChI=1S/C18H15F3N4O/c1-11-3-5-12(6-4-11)17(26)23-13-7-8-14(22-10-13)15-9-16(18(19,20)21)24-25(15)2/h3-10H,1-2H3,(H,23,26) |
| InChIKey | HCIGIQURAFISCD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |