C12H12F3N3O — CID 91338292
5-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]pyridine (PubChem CID 91338292) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 5-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]pyridine.
| Compound Name | 5-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 91338292 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]pyridine |
| SMILES | CCOc1ccc(-c2cc(C(F)(F)F)nn2C)nc1 |
| InChI | InChI=1S/C12H12F3N3O/c1-3-19-8-4-5-9(16-7-8)10-6-11(12(13,14)15)17-18(10)2/h4-7H,3H2,1-2H3 |
| InChIKey | FBLSXOGEHHAAAB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |