C27H23F4N5O — CID 21366568
1-(3-fluoronaphthalen-2-yl)-N-[4-(piperidine-1-carboximidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 21366568) has the molecular formula C27H23F4N5O and a molecular weight of 509.51 g/mol. Its IUPAC name is 1-(3-fluoronaphthalen-2-yl)-N-[4-(piperidine-1-carboximidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-fluoronaphthalen-2-yl)-N-[4-(piperidine-1-carboximidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 21366568 |
| Molecular Formula | C27H23F4N5O |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 1-(3-fluoronaphthalen-2-yl)-N-[4-(piperidine-1-carboximidoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2cc(C(F)(F)F)nn2-c2cc3ccccc3cc2F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C27H23F4N5O/c28-21-14-18-6-2-3-7-19(18)15-22(21)36-23(16-24(34-36)27(29,30)31)26(37)33-20-10-8-17(9-11-20)25(32)35-12-4-1-5-13-35/h2-3,6-11,14-16,32H,1,4-5,12-13H2,(H,33,37)/b32-25- |
| InChIKey | FLRSUDKFRMHGRR-MKCFTUBBSA-N |
| XLogP | 6.25 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|