C27H27N5O4S — CID 20595082
5-methyl-2-(3-methylsulfonylnaphthalen-2-yl)-N-[4-(morpholine-4-carboximidoyl)phenyl]pyrazole-3-carboxamide (PubChem CID 20595082) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is 5-methyl-2-(3-methylsulfonylnaphthalen-2-yl)-N-[4-(morpholine-4-carboximidoyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-2-(3-methylsulfonylnaphthalen-2-yl)-N-[4-(morpholine-4-carboximidoyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 20595082 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 5-methyl-2-(3-methylsulfonylnaphthalen-2-yl)-N-[4-(morpholine-4-carboximidoyl)phenyl]pyrazole-3-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2cc(C)nn2-c2cc3ccccc3cc2S(C)(=O)=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H27N5O4S/c1-18-15-24(27(33)29-22-9-7-19(8-10-22)26(28)31-11-13-36-14-12-31)32(30-18)23-16-20-5-3-4-6-21(20)17-25(23)37(2,34)35/h3-10,15-17,28H,11-14H2,1-2H3,(H,29,33)/b28-26- |
| InChIKey | BCHNHQLZAYIQDU-SGEDCAFJSA-N |
| XLogP | 3.65 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|