C24H23N3O4 — CID 100926117
2-[7-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]naphthalen-2-yl]acetic acid (PubChem CID 100926117) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[7-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[7-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 100926117 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[7-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]naphthalen-2-yl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc3ccc(CC(=O)O)cc3c2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C24H23N3O4/c25-23(27-9-11-31-12-10-27)18-3-5-19(6-4-18)24(30)26-21-8-7-17-2-1-16(14-22(28)29)13-20(17)15-21/h1-8,13,15,25H,9-12,14H2,(H,26,30)(H,28,29)/b25-23- |
| InChIKey | DCPKRAJSFYMWMU-BZZOAKBMSA-N |
| XLogP | 3.38 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|