C20H25N7O4 — CID 174415408
4-[6-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]tetrazin-5-yl]butan-2-yl acetate (PubChem CID 174415408) has the molecular formula C20H25N7O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is 4-[6-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]tetrazin-5-yl]butan-2-yl acetate.
| Compound Name | 4-[6-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]tetrazin-5-yl]butan-2-yl acetate |
|---|---|
| PubChem CID | 174415408 |
| Molecular Formula | C20H25N7O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-[6-[[4-(morpholine-4-carboximidoyl)benzoyl]amino]tetrazin-5-yl]butan-2-yl acetate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2nnnnc2CCC(C)OC(C)=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H25N7O4/c1-13(31-14(2)28)3-8-17-19(24-26-25-23-17)22-20(29)16-6-4-15(5-7-16)18(21)27-9-11-30-12-10-27/h4-7,13,21H,3,8-12H2,1-2H3,(H,22,24,25,29)/b21-18- |
| InChIKey | ZKTVWYGNTIUBLD-UZYVYHOESA-N |
| XLogP | 1.06 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|