C31H29N3O6S — CID 68510130
N-[4-[2-(morpholine-4-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide (PubChem CID 68510130) has the molecular formula C31H29N3O6S and a molecular weight of 571.66 g/mol. Its IUPAC name is N-[4-[2-(morpholine-4-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide.
| Compound Name | N-[4-[2-(morpholine-4-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide |
|---|---|
| PubChem CID | 68510130 |
| Molecular Formula | C31H29N3O6S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | N-[4-[2-(morpholine-4-carbonyl)-3-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CC(C(=O)NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H29N3O6S/c35-29(24-7-2-1-3-8-24)32-26-13-10-22(11-14-26)20-28(31(37)34-16-18-40-19-17-34)30(36)33-41(38,39)27-15-12-23-6-4-5-9-25(23)21-27/h1-15,21,28H,16-20H2,(H,32,35)(H,33,36) |
| InChIKey | VJINUFPGGYBWHL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|