C31H30FN3O5S — CID 68507850
N,N-diethyl-2-[[4-[(4-fluorobenzoyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68507850) has the molecular formula C31H30FN3O5S and a molecular weight of 575.66 g/mol. Its IUPAC name is N,N-diethyl-2-[[4-[(4-fluorobenzoyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | N,N-diethyl-2-[[4-[(4-fluorobenzoyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68507850 |
| Molecular Formula | C31H30FN3O5S |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | N,N-diethyl-2-[[4-[(4-fluorobenzoyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1ccc(NC(=O)c2ccc(F)cc2)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H30FN3O5S/c1-3-35(4-2)31(38)28(30(37)34-41(39,40)27-18-13-22-7-5-6-8-24(22)20-27)19-21-9-16-26(17-10-21)33-29(36)23-11-14-25(32)15-12-23/h5-18,20,28H,3-4,19H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | CVRHKUIYNFWMNE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|