C33H35FN4O5S — CID 68507261
2-[3-[4-[(2-amino-6-fluorobenzoyl)amino]phenyl]propyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68507261) has the molecular formula C33H35FN4O5S and a molecular weight of 618.73 g/mol. Its IUPAC name is 2-[3-[4-[(2-amino-6-fluorobenzoyl)amino]phenyl]propyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | 2-[3-[4-[(2-amino-6-fluorobenzoyl)amino]phenyl]propyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68507261 |
| Molecular Formula | C33H35FN4O5S |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | 2-[3-[4-[(2-amino-6-fluorobenzoyl)amino]phenyl]propyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(CCCc1ccc(NC(=O)c2c(N)cccc2F)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H35FN4O5S/c1-3-38(4-2)33(41)27(31(39)37-44(42,43)26-20-17-23-10-5-6-11-24(23)21-26)12-7-9-22-15-18-25(19-16-22)36-32(40)30-28(34)13-8-14-29(30)35/h5-6,8,10-11,13-21,27H,3-4,7,9,12,35H2,1-2H3,(H,36,40)(H,37,39) |
| InChIKey | KBSSTFPOWDNTDT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|