C30H31N3O6S — CID 68503547
N,N-diethyl-2-[[4-[(3-methylfuran-2-carbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68503547) has the molecular formula C30H31N3O6S and a molecular weight of 561.66 g/mol. Its IUPAC name is N,N-diethyl-2-[[4-[(3-methylfuran-2-carbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | N,N-diethyl-2-[[4-[(3-methylfuran-2-carbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68503547 |
| Molecular Formula | C30H31N3O6S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N,N-diethyl-2-[[4-[(3-methylfuran-2-carbonyl)amino]phenyl]methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1ccc(NC(=O)c2occc2C)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H31N3O6S/c1-4-33(5-2)30(36)26(18-21-10-13-24(14-11-21)31-29(35)27-20(3)16-17-39-27)28(34)32-40(37,38)25-15-12-22-8-6-7-9-23(22)19-25/h6-17,19,26H,4-5,18H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | SUQKUDBNSFQBGR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|