C31H30ClN3O5S — CID 68510706
2-[[4-[(3-chlorobenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68510706) has the molecular formula C31H30ClN3O5S and a molecular weight of 592.12 g/mol. Its IUPAC name is 2-[[4-[(3-chlorobenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | 2-[[4-[(3-chlorobenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68510706 |
| Molecular Formula | C31H30ClN3O5S |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[[4-[(3-chlorobenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1ccc(NC(=O)c2cccc(Cl)c2)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H30ClN3O5S/c1-3-35(4-2)31(38)28(30(37)34-41(39,40)27-17-14-22-8-5-6-9-23(22)20-27)18-21-12-15-26(16-13-21)33-29(36)24-10-7-11-25(32)19-24/h5-17,19-20,28H,3-4,18H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | HQMZHCHJVWKFGO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|