C20H16ClNNa2O5S — CID 68510403
CID 68510403 (PubChem CID 68510403) has the molecular formula C20H16ClNNa2O5S and a molecular weight of 463.85 g/mol.
| Compound Name | CID 68510403 |
|---|---|
| PubChem CID | 68510403 |
| Molecular Formula | C20H16ClNNa2O5S |
| Molecular Weight | 463.85 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | — |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1.[Na].[Na] |
| InChI | InChI=1S/C20H16ClNO5S.2Na/c21-16-8-5-13(6-9-16)11-18(20(24)25)19(23)22-28(26,27)17-10-7-14-3-1-2-4-15(14)12-17;;/h1-10,12,18H,11H2,(H,22,23)(H,24,25);; |
| InChIKey | HWDODDZCOOXSKV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|