C33H27N3O6S — CID 68512012
N-benzhydryl-N'-naphthalen-2-ylsulfonyl-2-[(4-nitrophenyl)methyl]propanediamide (PubChem CID 68512012) has the molecular formula C33H27N3O6S and a molecular weight of 593.66 g/mol. Its IUPAC name is N-benzhydryl-N'-naphthalen-2-ylsulfonyl-2-[(4-nitrophenyl)methyl]propanediamide.
| Compound Name | N-benzhydryl-N'-naphthalen-2-ylsulfonyl-2-[(4-nitrophenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 68512012 |
| Molecular Formula | C33H27N3O6S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | N-benzhydryl-N'-naphthalen-2-ylsulfonyl-2-[(4-nitrophenyl)methyl]propanediamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C(Cc1ccc([N+](=O)[O-])cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H27N3O6S/c37-32(34-31(25-10-3-1-4-11-25)26-12-5-2-6-13-26)30(21-23-15-18-28(19-16-23)36(39)40)33(38)35-43(41,42)29-20-17-24-9-7-8-14-27(24)22-29/h1-20,22,30-31H,21H2,(H,34,37)(H,35,38) |
| InChIKey | YVDHLDFVHYOEPA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|