C26H23N2O6P — CID 11799246
[1-(naphthalen-2-ylmethoxycarbonylamino)-2-(4-nitrophenyl)ethyl]-phenylphosphinic acid (PubChem CID 11799246) has the molecular formula C26H23N2O6P and a molecular weight of 490.45 g/mol. Its IUPAC name is [1-(naphthalen-2-ylmethoxycarbonylamino)-2-(4-nitrophenyl)ethyl]-phenylphosphinic acid.
| Compound Name | [1-(naphthalen-2-ylmethoxycarbonylamino)-2-(4-nitrophenyl)ethyl]-phenylphosphinic acid |
|---|---|
| PubChem CID | 11799246 |
| Molecular Formula | C26H23N2O6P |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [1-(naphthalen-2-ylmethoxycarbonylamino)-2-(4-nitrophenyl)ethyl]-phenylphosphinic acid |
| SMILES | O=C(NC(Cc1ccc([N+](=O)[O-])cc1)P(=O)(O)c1ccccc1)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H23N2O6P/c29-26(34-18-20-10-13-21-6-4-5-7-22(21)16-20)27-25(35(32,33)24-8-2-1-3-9-24)17-19-11-14-23(15-12-19)28(30)31/h1-16,25H,17-18H2,(H,27,29)(H,32,33) |
| InChIKey | LIUFQOLPYVSUMK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|