C21H16N2O5S — CID 68507305
2-[(4-cyanophenyl)methyl]-3-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid (PubChem CID 68507305) has the molecular formula C21H16N2O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methyl]-3-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid.
| Compound Name | 2-[(4-cyanophenyl)methyl]-3-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68507305 |
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[(4-cyanophenyl)methyl]-3-(naphthalen-2-ylsulfonylamino)-3-oxopropanoic acid |
| SMILES | N#Cc1ccc(CC(C(=O)O)C(=O)NS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H16N2O5S/c22-13-15-7-5-14(6-8-15)11-19(21(25)26)20(24)23-29(27,28)18-10-9-16-3-1-2-4-17(16)12-18/h1-10,12,19H,11H2,(H,23,24)(H,25,26) |
| InChIKey | FRQCRMSUFSLPTQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|