C34H30N2O5S — CID 68553893
N-benzhydryl-2-[(4-methoxyphenyl)methyl]-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 68553893) has the molecular formula C34H30N2O5S and a molecular weight of 578.69 g/mol. Its IUPAC name is N-benzhydryl-2-[(4-methoxyphenyl)methyl]-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | N-benzhydryl-2-[(4-methoxyphenyl)methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68553893 |
| Molecular Formula | C34H30N2O5S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | N-benzhydryl-2-[(4-methoxyphenyl)methyl]-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | COc1ccc(CC(C(=O)NC(c2ccccc2)c2ccccc2)C(=O)NS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C34H30N2O5S/c1-41-29-19-16-24(17-20-29)22-31(33(37)35-32(26-11-4-2-5-12-26)27-13-6-3-7-14-27)34(38)36-42(39,40)30-21-18-25-10-8-9-15-28(25)23-30/h2-21,23,31-32H,22H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | WXZNJEWSNIARAW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|