C29H29N3O5S — CID 68508297
2-[(4-amino-3-methoxyphenyl)methyl]-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide (PubChem CID 68508297) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is 2-[(4-amino-3-methoxyphenyl)methyl]-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide.
| Compound Name | 2-[(4-amino-3-methoxyphenyl)methyl]-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide |
|---|---|
| PubChem CID | 68508297 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-[(4-amino-3-methoxyphenyl)methyl]-N-ethyl-N'-naphthalen-2-ylsulfonyl-N-phenylpropanediamide |
| SMILES | CCN(C(=O)C(Cc1ccc(N)c(OC)c1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O5S/c1-3-32(23-11-5-4-6-12-23)29(34)25(17-20-13-16-26(30)27(18-20)37-2)28(33)31-38(35,36)24-15-14-21-9-7-8-10-22(21)19-24/h4-16,18-19,25H,3,17,30H2,1-2H3,(H,31,33) |
| InChIKey | QXUOSVSIFCFNJJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|