C21H27N3O4S — CID 68507620
2-[(4-aminophenyl)methyl]-N-ethyl-N-phenyl-N'-propylsulfonylpropanediamide (PubChem CID 68507620) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl]-N-ethyl-N-phenyl-N'-propylsulfonylpropanediamide.
| Compound Name | 2-[(4-aminophenyl)methyl]-N-ethyl-N-phenyl-N'-propylsulfonylpropanediamide |
|---|---|
| PubChem CID | 68507620 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[(4-aminophenyl)methyl]-N-ethyl-N-phenyl-N'-propylsulfonylpropanediamide |
| SMILES | CCCS(=O)(=O)NC(=O)C(Cc1ccc(N)cc1)C(=O)N(CC)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O4S/c1-3-14-29(27,28)23-20(25)19(15-16-10-12-17(22)13-11-16)21(26)24(4-2)18-8-6-5-7-9-18/h5-13,19H,3-4,14-15,22H2,1-2H3,(H,23,25) |
| InChIKey | HNFWESZFFYUJHE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|