C32H30N2O4S — CID 68512049
N-ethyl-N-phenyl-N'-(2-phenylethenylsulfonyl)-2-[(3-phenylphenyl)methyl]propanediamide (PubChem CID 68512049) has the molecular formula C32H30N2O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is N-ethyl-N-phenyl-N'-(2-phenylethenylsulfonyl)-2-[(3-phenylphenyl)methyl]propanediamide.
| Compound Name | N-ethyl-N-phenyl-N'-(2-phenylethenylsulfonyl)-2-[(3-phenylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 68512049 |
| Molecular Formula | C32H30N2O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | N-ethyl-N-phenyl-N'-(2-phenylethenylsulfonyl)-2-[(3-phenylphenyl)methyl]propanediamide |
| SMILES | CCN(C(=O)C(Cc1cccc(-c2ccccc2)c1)C(=O)NS(=O)(=O)C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O4S/c1-2-34(29-19-10-5-11-20-29)32(36)30(24-26-15-12-18-28(23-26)27-16-8-4-9-17-27)31(35)33-39(37,38)22-21-25-13-6-3-7-14-25/h3-23,30H,2,24H2,1H3,(H,33,35) |
| InChIKey | NPJOGNXNSDSFBT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|