C29H30F2N2O4S — CID 68506234
N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-pentan-3-yl-N'-(2-phenylethenylsulfonyl)propanediamide (PubChem CID 68506234) has the molecular formula C29H30F2N2O4S and a molecular weight of 540.63 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-pentan-3-yl-N'-(2-phenylethenylsulfonyl)propanediamide.
| Compound Name | N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-pentan-3-yl-N'-(2-phenylethenylsulfonyl)propanediamide |
|---|---|
| PubChem CID | 68506234 |
| Molecular Formula | C29H30F2N2O4S |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-pentan-3-yl-N'-(2-phenylethenylsulfonyl)propanediamide |
| SMILES | CCC(CC)N(C(=O)C(Cc1ccc(F)cc1)C(=O)NS(=O)(=O)C=Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H30F2N2O4S/c1-3-25(4-2)33(26-16-14-24(31)15-17-26)29(35)27(20-22-10-12-23(30)13-11-22)28(34)32-38(36,37)19-18-21-8-6-5-7-9-21/h5-19,25,27H,3-4,20H2,1-2H3,(H,32,34) |
| InChIKey | IZYQQZQCEDYOMI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|