C28H26FN3O4S — CID 68506196
2-[(3-cyanophenyl)methyl]-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide (PubChem CID 68506196) has the molecular formula C28H26FN3O4S and a molecular weight of 519.60 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methyl]-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide.
| Compound Name | 2-[(3-cyanophenyl)methyl]-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 68506196 |
| Molecular Formula | C28H26FN3O4S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-[(3-cyanophenyl)methyl]-N-(4-fluorophenyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide |
| SMILES | CC(C)N(C(=O)C(Cc1cccc(C#N)c1)C(=O)NS(=O)(=O)C=Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H26FN3O4S/c1-20(2)32(25-13-11-24(29)12-14-25)28(34)26(18-22-9-6-10-23(17-22)19-30)27(33)31-37(35,36)16-15-21-7-4-3-5-8-21/h3-17,20,26H,18H2,1-2H3,(H,31,33) |
| InChIKey | RADQCKKJJYRELO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|