C25H32N2O4S — CID 68506045
N-benzyl-2-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide (PubChem CID 68506045) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-benzyl-2-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide.
| Compound Name | N-benzyl-2-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 68506045 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-benzyl-2-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)-N-propan-2-ylpropanediamide |
| SMILES | CC(C)CC(C(=O)NS(=O)(=O)C=Cc1ccccc1)C(=O)N(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C25H32N2O4S/c1-19(2)17-23(25(29)27(20(3)4)18-22-13-9-6-10-14-22)24(28)26-32(30,31)16-15-21-11-7-5-8-12-21/h5-16,19-20,23H,17-18H2,1-4H3,(H,26,28) |
| InChIKey | XDWWXQZMXCQPCA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|