C16H17NO5S — CID 87479038
ethyl 2-[[(E)-2-phenylethenyl]sulfonylcarbamoyl]pent-4-ynoate (PubChem CID 87479038) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-phenylethenyl]sulfonylcarbamoyl]pent-4-ynoate.
| Compound Name | ethyl 2-[[(E)-2-phenylethenyl]sulfonylcarbamoyl]pent-4-ynoate |
|---|---|
| PubChem CID | 87479038 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | ethyl 2-[[(E)-2-phenylethenyl]sulfonylcarbamoyl]pent-4-ynoate |
| SMILES | C#CCC(C(=O)NS(=O)(=O)/C=C/c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H17NO5S/c1-3-8-14(16(19)22-4-2)15(18)17-23(20,21)12-11-13-9-6-5-7-10-13/h1,5-7,9-12,14H,4,8H2,2H3,(H,17,18)/b12-11+ |
| InChIKey | DKKRFGBKKZWSKA-VAWYXSNFSA-N |
| XLogP | 1.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|