C24H25N3O5S — CID 68506287
ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate (PubChem CID 68506287) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate.
| Compound Name | ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 68506287 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(Cc1cnn(Cc2ccccc2)c1)C(=O)NS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-2-32-24(29)22(15-21-16-25-27(18-21)17-20-11-7-4-8-12-20)23(28)26-33(30,31)14-13-19-9-5-3-6-10-19/h3-14,16,18,22H,2,15,17H2,1H3,(H,26,28)/b14-13+ |
| InChIKey | AWNKAZAAJRGXSM-BUHFOSPRSA-N |
| XLogP | 2.77 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|