C26H30N4O4S — CID 68513135
2-[(1-benzylpyrazol-4-yl)methyl]-N,N-diethyl-N'-[(E)-2-phenylethenyl]sulfonylpropanediamide (PubChem CID 68513135) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-[(1-benzylpyrazol-4-yl)methyl]-N,N-diethyl-N'-[(E)-2-phenylethenyl]sulfonylpropanediamide.
| Compound Name | 2-[(1-benzylpyrazol-4-yl)methyl]-N,N-diethyl-N'-[(E)-2-phenylethenyl]sulfonylpropanediamide |
|---|---|
| PubChem CID | 68513135 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[(1-benzylpyrazol-4-yl)methyl]-N,N-diethyl-N'-[(E)-2-phenylethenyl]sulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1cnn(Cc2ccccc2)c1)C(=O)NS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H30N4O4S/c1-3-29(4-2)26(32)24(17-23-18-27-30(20-23)19-22-13-9-6-10-14-22)25(31)28-35(33,34)16-15-21-11-7-5-8-12-21/h5-16,18,20,24H,3-4,17,19H2,1-2H3,(H,28,31)/b16-15+ |
| InChIKey | WYASMRRAYUPWIM-FOCLMDBBSA-N |
| XLogP | 3.08 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|