C20H25N3O3 — CID 68507886
3-(diethylamino)-3-oxo-2-[[1-(3-phenylprop-2-enyl)pyrazol-4-yl]methyl]propanoic acid (PubChem CID 68507886) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-(diethylamino)-3-oxo-2-[[1-(3-phenylprop-2-enyl)pyrazol-4-yl]methyl]propanoic acid.
| Compound Name | 3-(diethylamino)-3-oxo-2-[[1-(3-phenylprop-2-enyl)pyrazol-4-yl]methyl]propanoic acid |
|---|---|
| PubChem CID | 68507886 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-(diethylamino)-3-oxo-2-[[1-(3-phenylprop-2-enyl)pyrazol-4-yl]methyl]propanoic acid |
| SMILES | CCN(CC)C(=O)C(Cc1cnn(CC=Cc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C20H25N3O3/c1-3-22(4-2)19(24)18(20(25)26)13-17-14-21-23(15-17)12-8-11-16-9-6-5-7-10-16/h5-11,14-15,18H,3-4,12-13H2,1-2H3,(H,25,26) |
| InChIKey | UUTUUKJBYAAGHP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|