C28H29N3O3 — CID 68505814
ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-[ethyl(naphthalen-2-yl)amino]-3-oxopropanoate (PubChem CID 68505814) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-[ethyl(naphthalen-2-yl)amino]-3-oxopropanoate.
| Compound Name | ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-[ethyl(naphthalen-2-yl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 68505814 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | ethyl 2-[(1-benzylpyrazol-4-yl)methyl]-3-[ethyl(naphthalen-2-yl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1cnn(Cc2ccccc2)c1)C(=O)N(CC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H29N3O3/c1-3-31(25-15-14-23-12-8-9-13-24(23)17-25)27(32)26(28(33)34-4-2)16-22-18-29-30(20-22)19-21-10-6-5-7-11-21/h5-15,17-18,20,26H,3-4,16,19H2,1-2H3 |
| InChIKey | SBKVIWVXHTWJNG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|