C27H26N2O6S — CID 68505367
4-[2-[ethyl(phenyl)carbamoyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propyl]benzoic acid (PubChem CID 68505367) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is 4-[2-[ethyl(phenyl)carbamoyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propyl]benzoic acid.
| Compound Name | 4-[2-[ethyl(phenyl)carbamoyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propyl]benzoic acid |
|---|---|
| PubChem CID | 68505367 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 4-[2-[ethyl(phenyl)carbamoyl]-3-oxo-3-[[(E)-2-phenylethenyl]sulfonylamino]propyl]benzoic acid |
| SMILES | CCN(C(=O)C(Cc1ccc(C(=O)O)cc1)C(=O)NS(=O)(=O)/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O6S/c1-2-29(23-11-7-4-8-12-23)26(31)24(19-21-13-15-22(16-14-21)27(32)33)25(30)28-36(34,35)18-17-20-9-5-3-6-10-20/h3-18,24H,2,19H2,1H3,(H,28,30)(H,32,33)/b18-17+ |
| InChIKey | BROSTDFXTQHWFW-ISLYRVAYSA-N |
| XLogP | 3.71 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|