C27H27N3O7S — CID 68507266
N-ethyl-2-[(4-methoxy-3-nitrophenyl)methyl]-N-phenyl-N'-(2-phenylethenylsulfonyl)propanediamide (PubChem CID 68507266) has the molecular formula C27H27N3O7S and a molecular weight of 537.59 g/mol. Its IUPAC name is N-ethyl-2-[(4-methoxy-3-nitrophenyl)methyl]-N-phenyl-N'-(2-phenylethenylsulfonyl)propanediamide.
| Compound Name | N-ethyl-2-[(4-methoxy-3-nitrophenyl)methyl]-N-phenyl-N'-(2-phenylethenylsulfonyl)propanediamide |
|---|---|
| PubChem CID | 68507266 |
| Molecular Formula | C27H27N3O7S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | N-ethyl-2-[(4-methoxy-3-nitrophenyl)methyl]-N-phenyl-N'-(2-phenylethenylsulfonyl)propanediamide |
| SMILES | CCN(C(=O)C(Cc1ccc(OC)c([N+](=O)[O-])c1)C(=O)NS(=O)(=O)C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O7S/c1-3-29(22-12-8-5-9-13-22)27(32)23(18-21-14-15-25(37-2)24(19-21)30(33)34)26(31)28-38(35,36)17-16-20-10-6-4-7-11-20/h4-17,19,23H,3,18H2,1-2H3,(H,28,31) |
| InChIKey | UQDQYUCSUJWIQM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|