C28H28F2N2O4S — CID 68511463
N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)propanediamide (PubChem CID 68511463) has the molecular formula C28H28F2N2O4S and a molecular weight of 526.61 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)propanediamide.
| Compound Name | N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)propanediamide |
|---|---|
| PubChem CID | 68511463 |
| Molecular Formula | C28H28F2N2O4S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)-N'-(2-phenylethenylsulfonyl)propanediamide |
| SMILES | CC(C)CN(C(=O)C(Cc1ccc(F)cc1)C(=O)NS(=O)(=O)C=Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H28F2N2O4S/c1-20(2)19-32(25-14-12-24(30)13-15-25)28(34)26(18-22-8-10-23(29)11-9-22)27(33)31-37(35,36)17-16-21-6-4-3-5-7-21/h3-17,20,26H,18-19H2,1-2H3,(H,31,33) |
| InChIKey | YHRQIJMGJTYCOW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|