C22H22Cl2N2O4S — CID 68507910
N-(2,3-dichlorophenyl)-N-ethyl-N'-(2-phenylethenylsulfonyl)-2-prop-2-enylpropanediamide (PubChem CID 68507910) has the molecular formula C22H22Cl2N2O4S and a molecular weight of 481.40 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N-ethyl-N'-(2-phenylethenylsulfonyl)-2-prop-2-enylpropanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-N-ethyl-N'-(2-phenylethenylsulfonyl)-2-prop-2-enylpropanediamide |
|---|---|
| PubChem CID | 68507910 |
| Molecular Formula | C22H22Cl2N2O4S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N-ethyl-N'-(2-phenylethenylsulfonyl)-2-prop-2-enylpropanediamide |
| SMILES | C=CCC(C(=O)NS(=O)(=O)C=Cc1ccccc1)C(=O)N(CC)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H22Cl2N2O4S/c1-3-9-17(22(28)26(4-2)19-13-8-12-18(23)20(19)24)21(27)25-31(29,30)15-14-16-10-6-5-7-11-16/h3,5-8,10-15,17H,1,4,9H2,2H3,(H,25,27) |
| InChIKey | TWPVXMFLRATNDS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|