C24H25FN2O4S — CID 68513097
2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide (PubChem CID 68513097) has the molecular formula C24H25FN2O4S and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide.
| Compound Name | 2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide |
|---|---|
| PubChem CID | 68513097 |
| Molecular Formula | C24H25FN2O4S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide |
| SMILES | C=CCC(C(=O)NS(=O)(=O)/C=C/c1ccccc1)C(=O)N1c2ccc(F)cc2CCC1C |
| InChI | InChI=1S/C24H25FN2O4S/c1-3-7-21(23(28)26-32(30,31)15-14-18-8-5-4-6-9-18)24(29)27-17(2)10-11-19-16-20(25)12-13-22(19)27/h3-6,8-9,12-17,21H,1,7,10-11H2,2H3,(H,26,28)/b15-14+ |
| InChIKey | BFTDJVSEOZLQKK-CCEZHUSRSA-N |
| XLogP | 3.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|