C20H20FNO — CID 3648502
1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 3648502) has the molecular formula C20H20FNO and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3648502 |
| Molecular Formula | C20H20FNO |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C=CC(=O)N2c3ccc(F)cc3CCC2C)cc1 |
| InChI | InChI=1S/C20H20FNO/c1-14-3-6-16(7-4-14)8-12-20(23)22-15(2)5-9-17-13-18(21)10-11-19(17)22/h3-4,6-8,10-13,15H,5,9H2,1-2H3 |
| InChIKey | KZPWKRYVTMUXFO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|