C23H26FNO — CID 5139382
3-(4-tert-butylphenyl)-1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one (PubChem CID 5139382) has the molecular formula C23H26FNO and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5139382 |
| Molecular Formula | C23H26FNO |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)C=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26FNO/c1-16-5-9-18-15-20(24)12-13-21(18)25(16)22(26)14-8-17-6-10-19(11-7-17)23(2,3)4/h6-8,10-16H,5,9H2,1-4H3 |
| InChIKey | QYEYOUWYUJLPLC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|