C20H20FNO2 — CID 898698
(E)-1-[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 898698) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is (E)-1-[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 898698 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (E)-1-[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2c3ccc(F)cc3CC[C@H]2C)cc1 |
| InChI | InChI=1S/C20H20FNO2/c1-14-3-7-16-13-17(21)8-11-19(16)22(14)20(23)12-6-15-4-9-18(24-2)10-5-15/h4-6,8-14H,3,7H2,1-2H3/b12-6+/t14-/m1/s1 |
| InChIKey | ADGNMTYOBLMDMP-TZWLIRKLSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|