C20H17FN2O3 — CID 2932548
2-[2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 2932548) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is 2-[2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2932548 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17FN2O3/c1-12-6-7-13-10-14(21)8-9-17(13)23(12)18(24)11-22-19(25)15-4-2-3-5-16(15)20(22)26/h2-5,8-10,12H,6-7,11H2,1H3 |
| InChIKey | VXLCTYCNPCKCHJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|