C20H16FN3O5 — CID 1290151
2-[2-[(2S)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 1290151) has the molecular formula C20H16FN3O5 and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-[2-[(2S)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[(2S)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 1290151 |
| Molecular Formula | C20H16FN3O5 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[2-[(2S)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | C[C@H]1CCc2cc(F)ccc2N1C(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C20H16FN3O5/c1-11-5-6-12-9-13(21)7-8-15(12)23(11)17(25)10-22-19(26)14-3-2-4-16(24(28)29)18(14)20(22)27/h2-4,7-9,11H,5-6,10H2,1H3/t11-/m0/s1 |
| InChIKey | YWQMNRUWWANENM-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|