C20H17N3O7S — CID 55661110
2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 55661110) has the molecular formula C20H17N3O7S and a molecular weight of 443.44 g/mol. Its IUPAC name is 2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 55661110 |
| Molecular Formula | C20H17N3O7S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C20H17N3O7S/c1-31(29,30)13-7-8-15-12(10-13)4-3-9-21(15)17(24)11-22-19(25)14-5-2-6-16(23(27)28)18(14)20(22)26/h2,5-8,10H,3-4,9,11H2,1H3 |
| InChIKey | POXLQCABYKFTFF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|