C20H18N2O5S — CID 55661378
2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 55661378) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55661378 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-[2-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18N2O5S/c1-28(26,27)14-8-9-17-13(11-14)5-4-10-21(17)18(23)12-22-19(24)15-6-2-3-7-16(15)20(22)25/h2-3,6-9,11H,4-5,10,12H2,1H3 |
| InChIKey | YGPHLUIIGDSCMM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|