C15H15FN4O3 — CID 11838020
1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitropyrazol-1-yl)ethanone (PubChem CID 11838020) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 11838020 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-(4-nitropyrazol-1-yl)ethanone |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C15H15FN4O3/c1-10-2-3-11-6-12(16)4-5-14(11)19(10)15(21)9-18-8-13(7-17-18)20(22)23/h4-8,10H,2-3,9H2,1H3 |
| InChIKey | MPHGRGSUYWIERB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|