C17H16FN3O3 — CID 2897881
6-fluoro-2-methyl-N-(4-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 2897881) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 6-fluoro-2-methyl-N-(4-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | 6-fluoro-2-methyl-N-(4-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 2897881 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 6-fluoro-2-methyl-N-(4-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16FN3O3/c1-11-2-3-12-10-13(18)4-9-16(12)20(11)17(22)19-14-5-7-15(8-6-14)21(23)24/h4-11H,2-3H2,1H3,(H,19,22) |
| InChIKey | DSUONPYYEYDFTJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|