C22H18Cl2N2O5 — CID 55468371
[2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 55468371) has the molecular formula C22H18Cl2N2O5 and a molecular weight of 461.30 g/mol. Its IUPAC name is [2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55468371 |
| Molecular Formula | C22H18Cl2N2O5 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CC1CCc2ccccc2N1C(=O)COC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C22H18Cl2N2O5/c1-12-6-7-13-4-2-3-5-18(13)26(12)19(27)11-31-20(28)10-25-21(29)14-8-16(23)17(24)9-15(14)22(25)30/h2-5,8-9,12H,6-7,10-11H2,1H3 |
| InChIKey | WNQOAQLZJRDBPR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|