C20H20Cl2N2O7 — CID 35776823
ethyl 1-[2-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 35776823) has the molecular formula C20H20Cl2N2O7 and a molecular weight of 471.29 g/mol. Its IUPAC name is ethyl 1-[2-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 35776823 |
| Molecular Formula | C20H20Cl2N2O7 |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | ethyl 1-[2-[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)CC1 |
| InChI | InChI=1S/C20H20Cl2N2O7/c1-2-30-20(29)11-3-5-23(6-4-11)16(25)10-31-17(26)9-24-18(27)12-7-14(21)15(22)8-13(12)19(24)28/h7-8,11H,2-6,9-10H2,1H3 |
| InChIKey | SSJJLTDMWSZKKO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|