C17H20ClNO6 — CID 8604247
ethyl 1-[2-(5-chloro-2-hydroxybenzoyl)oxyacetyl]piperidine-4-carboxylate (PubChem CID 8604247) has the molecular formula C17H20ClNO6 and a molecular weight of 369.80 g/mol. Its IUPAC name is ethyl 1-[2-(5-chloro-2-hydroxybenzoyl)oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(5-chloro-2-hydroxybenzoyl)oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8604247 |
| Molecular Formula | C17H20ClNO6 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 1-[2-(5-chloro-2-hydroxybenzoyl)oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)c2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C17H20ClNO6/c1-2-24-16(22)11-5-7-19(8-6-11)15(21)10-25-17(23)13-9-12(18)3-4-14(13)20/h3-4,9,11,20H,2,5-8,10H2,1H3 |
| InChIKey | NHLOXUVAZOZCHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |