C24H25N5O4S — CID 68511911
2-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide (PubChem CID 68511911) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide.
| Compound Name | 2-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide |
|---|---|
| PubChem CID | 68511911 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]-N-[(E)-2-phenylethenyl]sulfonylpent-4-enamide |
| SMILES | C=CCC(C(=O)NS(=O)(=O)/C=C/c1ccccc1)C(=O)N1CCN(c2ccc(C#N)cn2)CC1 |
| InChI | InChI=1S/C24H25N5O4S/c1-2-6-21(23(30)27-34(32,33)16-11-19-7-4-3-5-8-19)24(31)29-14-12-28(13-15-29)22-10-9-20(17-25)18-26-22/h2-5,7-11,16,18,21H,1,6,12-15H2,(H,27,30)/b16-11+ |
| InChIKey | GGXMKAZJGHKRSI-LFIBNONCSA-N |
| XLogP | 1.91 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|