C20H21FN2OS — CID 3290302
2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxo-N-(1-phenylethyl)ethanethioamide (PubChem CID 3290302) has the molecular formula C20H21FN2OS and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxo-N-(1-phenylethyl)ethanethioamide.
| Compound Name | 2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxo-N-(1-phenylethyl)ethanethioamide |
|---|---|
| PubChem CID | 3290302 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxo-N-(1-phenylethyl)ethanethioamide |
| SMILES | CC(NC(=S)C(=O)N1c2ccc(F)cc2CCC1C)c1ccccc1 |
| InChI | InChI=1S/C20H21FN2OS/c1-13-8-9-16-12-17(21)10-11-18(16)23(13)20(24)19(25)22-14(2)15-6-4-3-5-7-15/h3-7,10-14H,8-9H2,1-2H3,(H,22,25) |
| InChIKey | BATUKZFNTMMJER-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|