C33H34N2O6S — CID 68507721
ethyl 4-[4-[ethyl(phenyl)carbamoyl]-5-(naphthalen-2-ylsulfonylamino)-5-oxopentyl]benzoate (PubChem CID 68507721) has the molecular formula C33H34N2O6S and a molecular weight of 586.71 g/mol. Its IUPAC name is ethyl 4-[4-[ethyl(phenyl)carbamoyl]-5-(naphthalen-2-ylsulfonylamino)-5-oxopentyl]benzoate.
| Compound Name | ethyl 4-[4-[ethyl(phenyl)carbamoyl]-5-(naphthalen-2-ylsulfonylamino)-5-oxopentyl]benzoate |
|---|---|
| PubChem CID | 68507721 |
| Molecular Formula | C33H34N2O6S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | ethyl 4-[4-[ethyl(phenyl)carbamoyl]-5-(naphthalen-2-ylsulfonylamino)-5-oxopentyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCCC(C(=O)NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N(CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N2O6S/c1-3-35(28-14-6-5-7-15-28)32(37)30(16-10-11-24-17-19-26(20-18-24)33(38)41-4-2)31(36)34-42(39,40)29-22-21-25-12-8-9-13-27(25)23-29/h5-9,12-15,17-23,30H,3-4,10-11,16H2,1-2H3,(H,34,36) |
| InChIKey | XGFWPFWNNZIQNC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|