C32H34N4O5S — CID 25155945
(2S)-2-[[4-[(2-amino-5-methylbenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide (PubChem CID 25155945) has the molecular formula C32H34N4O5S and a molecular weight of 586.71 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-5-methylbenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide.
| Compound Name | (2S)-2-[[4-[(2-amino-5-methylbenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
|---|---|
| PubChem CID | 25155945 |
| Molecular Formula | C32H34N4O5S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-5-methylbenzoyl)amino]phenyl]methyl]-N,N-diethyl-N'-naphthalen-2-ylsulfonylpropanediamide |
| SMILES | CCN(CC)C(=O)[C@H](Cc1ccc(NC(=O)c2cc(C)ccc2N)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H34N4O5S/c1-4-36(5-2)32(39)28(31(38)35-42(40,41)26-16-13-23-8-6-7-9-24(23)20-26)19-22-11-14-25(15-12-22)34-30(37)27-18-21(3)10-17-29(27)33/h6-18,20,28H,4-5,19,33H2,1-3H3,(H,34,37)(H,35,38)/t28-/m1/s1 |
| InChIKey | IJHKUDATLCGQDS-MUUNZHRXSA-N |
| XLogP | 4.51 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|