C32H30F3N3O5S — CID 68512971
N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[4-[[2-(trifluoromethyl)benzoyl]amino]phenyl]methyl]propanediamide (PubChem CID 68512971) has the molecular formula C32H30F3N3O5S and a molecular weight of 625.67 g/mol. Its IUPAC name is N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[4-[[2-(trifluoromethyl)benzoyl]amino]phenyl]methyl]propanediamide.
| Compound Name | N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[4-[[2-(trifluoromethyl)benzoyl]amino]phenyl]methyl]propanediamide |
|---|---|
| PubChem CID | 68512971 |
| Molecular Formula | C32H30F3N3O5S |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | N,N-diethyl-N'-naphthalen-2-ylsulfonyl-2-[[4-[[2-(trifluoromethyl)benzoyl]amino]phenyl]methyl]propanediamide |
| SMILES | CCN(CC)C(=O)C(Cc1ccc(NC(=O)c2ccccc2C(F)(F)F)cc1)C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H30F3N3O5S/c1-3-38(4-2)31(41)27(30(40)37-44(42,43)25-18-15-22-9-5-6-10-23(22)20-25)19-21-13-16-24(17-14-21)36-29(39)26-11-7-8-12-28(26)32(33,34)35/h5-18,20,27H,3-4,19H2,1-2H3,(H,36,39)(H,37,40) |
| InChIKey | JTZQPIKERJTVBN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|